C10H13NO2S2 — CID 107033632
N-(2-methyloxolan-3-yl)-4-sulfanylthiophene-2-carboxamide (PubChem CID 107033632) has the molecular formula C10H13NO2S2 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-(2-methyloxolan-3-yl)-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-(2-methyloxolan-3-yl)-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107033632 |
| Molecular Formula | C10H13NO2S2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | N-(2-methyloxolan-3-yl)-4-sulfanylthiophene-2-carboxamide |
| SMILES | CC1OCCC1NC(=O)c1cc(S)cs1 |
| InChI | InChI=1S/C10H13NO2S2/c1-6-8(2-3-13-6)11-10(12)9-4-7(14)5-15-9/h4-6,8,14H,2-3H2,1H3,(H,11,12) |
| InChIKey | NGJFTVVMUHMAAO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|