C10H13N3O2 — CID 10703523
3-(2-carbamimidoylanilino)propanoic acid (PubChem CID 10703523) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-(2-carbamimidoylanilino)propanoic acid.
| Compound Name | 3-(2-carbamimidoylanilino)propanoic acid |
|---|---|
| PubChem CID | 10703523 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-(2-carbamimidoylanilino)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccccc1NCCC(=O)O |
| InChI | InChI=1S/C10H13N3O2/c11-10(12)7-3-1-2-4-8(7)13-6-5-9(14)15/h1-4,13H,5-6H2,(H3,11,12)(H,14,15) |
| InChIKey | KYLGDWWIZZXXAX-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|