C15H20N4O4 — CID 15233759
3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]butanoic acid (PubChem CID 15233759) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]butanoic acid.
| Compound Name | 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 15233759 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)NC(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C15H20N4O4/c1-9(8-14(22)23)18-12(20)6-7-13(21)19-11-4-2-10(3-5-11)15(16)17/h2-5,9H,6-8H2,1H3,(H3,16,17)(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | CJHDDXZTEOGYGR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|