C21H24N4O4 — CID 10363350
3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-phenylbutanoic acid (PubChem CID 10363350) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-phenylbutanoic acid.
| Compound Name | 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 10363350 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-4-phenylbutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)NC(CC(=O)O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H24N4O4/c22-21(23)15-6-8-16(9-7-15)24-18(26)10-11-19(27)25-17(13-20(28)29)12-14-4-2-1-3-5-14/h1-9,17H,10-13H2,(H3,22,23)(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | CAQDUHNPVUZFGR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|