C12H23N5 — CID 107040761
3-ethyl-N-methyl-1-[(1-methyltriazol-4-yl)methyl]piperidin-4-amine (PubChem CID 107040761) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is 3-ethyl-N-methyl-1-[(1-methyltriazol-4-yl)methyl]piperidin-4-amine.
| Compound Name | 3-ethyl-N-methyl-1-[(1-methyltriazol-4-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 107040761 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 3-ethyl-N-methyl-1-[(1-methyltriazol-4-yl)methyl]piperidin-4-amine |
| SMILES | CCC1CN(Cc2cn(C)nn2)CCC1NC |
| InChI | InChI=1S/C12H23N5/c1-4-10-7-17(6-5-12(10)13-2)9-11-8-16(3)15-14-11/h8,10,12-13H,4-7,9H2,1-3H3 |
| InChIKey | VKHRFZAVKDPZLL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |