C7H11FN4 — CID 131101712
4-[(3-fluoroazetidin-1-yl)methyl]-1-methyltriazole (PubChem CID 131101712) has the molecular formula C7H11FN4 and a molecular weight of 170.19 g/mol. Its IUPAC name is 4-[(3-fluoroazetidin-1-yl)methyl]-1-methyltriazole.
| Compound Name | 4-[(3-fluoroazetidin-1-yl)methyl]-1-methyltriazole |
|---|---|
| PubChem CID | 131101712 |
| Molecular Formula | C7H11FN4 |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.10 |
| IUPAC Name | 4-[(3-fluoroazetidin-1-yl)methyl]-1-methyltriazole |
| SMILES | Cn1cc(CN2CC(F)C2)nn1 |
| InChI | InChI=1S/C7H11FN4/c1-11-4-7(9-10-11)5-12-2-6(8)3-12/h4,6H,2-3,5H2,1H3 |
| InChIKey | DCTUYWYSGCKJPI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |