C10H19N5 — CID 107056206
3-methyl-1-[(1-methyltriazol-4-yl)methyl]-1,4-diazepane (PubChem CID 107056206) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 3-methyl-1-[(1-methyltriazol-4-yl)methyl]-1,4-diazepane.
| Compound Name | 3-methyl-1-[(1-methyltriazol-4-yl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 107056206 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 3-methyl-1-[(1-methyltriazol-4-yl)methyl]-1,4-diazepane |
| SMILES | CC1CN(Cc2cn(C)nn2)CCCN1 |
| InChI | InChI=1S/C10H19N5/c1-9-6-15(5-3-4-11-9)8-10-7-14(2)13-12-10/h7,9,11H,3-6,8H2,1-2H3 |
| InChIKey | PZYIONFXHJCRRA-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |