C12H24ClN5 — CID 120845822
(3S)-1-[(1-tert-butyltriazol-4-yl)methyl]-3-methylpiperazine;hydrochloride (PubChem CID 120845822) has the molecular formula C12H24ClN5 and a molecular weight of 273.81 g/mol. Its IUPAC name is (3S)-1-[(1-tert-butyltriazol-4-yl)methyl]-3-methylpiperazine;hydrochloride.
| Compound Name | (3S)-1-[(1-tert-butyltriazol-4-yl)methyl]-3-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120845822 |
| Molecular Formula | C12H24ClN5 |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (3S)-1-[(1-tert-butyltriazol-4-yl)methyl]-3-methylpiperazine;hydrochloride |
| SMILES | C[C@H]1CN(Cc2cn(C(C)(C)C)nn2)CCN1.Cl |
| InChI | InChI=1S/C12H23N5.ClH/c1-10-7-16(6-5-13-10)8-11-9-17(15-14-11)12(2,3)4;/h9-10,13H,5-8H2,1-4H3;1H/t10-;/m0./s1 |
| InChIKey | LHEDJVZGJOPHPH-PPHPATTJSA-N |
| XLogP | 1.25 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |