C13H26ClN5 — CID 120837955
1-[(1-tert-butyltriazol-4-yl)methyl]-N-methylpiperidin-3-amine;hydrochloride (PubChem CID 120837955) has the molecular formula C13H26ClN5 and a molecular weight of 287.84 g/mol. Its IUPAC name is 1-[(1-tert-butyltriazol-4-yl)methyl]-N-methylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-[(1-tert-butyltriazol-4-yl)methyl]-N-methylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120837955 |
| Molecular Formula | C13H26ClN5 |
| Molecular Weight | 287.84 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 1-[(1-tert-butyltriazol-4-yl)methyl]-N-methylpiperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(Cc2cn(C(C)(C)C)nn2)C1.Cl |
| InChI | InChI=1S/C13H25N5.ClH/c1-13(2,3)18-10-12(15-16-18)9-17-7-5-6-11(8-17)14-4;/h10-11,14H,5-9H2,1-4H3;1H |
| InChIKey | QZUXGVXCALMVLZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.84 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |