C12H24ClN5O — CID 120844444
[4-[(1-tert-butyltriazol-4-yl)methyl]morpholin-2-yl]methanamine;hydrochloride (PubChem CID 120844444) has the molecular formula C12H24ClN5O and a molecular weight of 289.81 g/mol. Its IUPAC name is [4-[(1-tert-butyltriazol-4-yl)methyl]morpholin-2-yl]methanamine;hydrochloride.
| Compound Name | [4-[(1-tert-butyltriazol-4-yl)methyl]morpholin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120844444 |
| Molecular Formula | C12H24ClN5O |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [4-[(1-tert-butyltriazol-4-yl)methyl]morpholin-2-yl]methanamine;hydrochloride |
| SMILES | CC(C)(C)n1cc(CN2CCOC(CN)C2)nn1.Cl |
| InChI | InChI=1S/C12H23N5O.ClH/c1-12(2,3)17-8-10(14-15-17)7-16-4-5-18-11(6-13)9-16;/h8,11H,4-7,9,13H2,1-3H3;1H |
| InChIKey | VAVGFWUFTNPZNQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |