C11H21N5 — CID 107055406
2-ethyl-5-methyl-1-[(1-methyltriazol-4-yl)methyl]piperazine (PubChem CID 107055406) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-ethyl-5-methyl-1-[(1-methyltriazol-4-yl)methyl]piperazine.
| Compound Name | 2-ethyl-5-methyl-1-[(1-methyltriazol-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 107055406 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 2-ethyl-5-methyl-1-[(1-methyltriazol-4-yl)methyl]piperazine |
| SMILES | CCC1CNC(C)CN1Cc1cn(C)nn1 |
| InChI | InChI=1S/C11H21N5/c1-4-11-5-12-9(2)6-16(11)8-10-7-15(3)14-13-10/h7,9,11-12H,4-6,8H2,1-3H3 |
| InChIKey | FKEDUOZVGCPQFV-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |