C12H13N3O4S — CID 107043081
2-[4-[(1-methyltriazol-4-yl)methylsulfonyl]phenyl]acetic acid (PubChem CID 107043081) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-[4-[(1-methyltriazol-4-yl)methylsulfonyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(1-methyltriazol-4-yl)methylsulfonyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 107043081 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-[4-[(1-methyltriazol-4-yl)methylsulfonyl]phenyl]acetic acid |
| SMILES | Cn1cc(CS(=O)(=O)c2ccc(CC(=O)O)cc2)nn1 |
| InChI | InChI=1S/C12H13N3O4S/c1-15-7-10(13-14-15)8-20(18,19)11-4-2-9(3-5-11)6-12(16)17/h2-5,7H,6,8H2,1H3,(H,16,17) |
| InChIKey | KDFNRAGMWASRQV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |