C14H20O4S — CID 82926769
2-[4-(2-ethylbutylsulfonyl)phenyl]acetic acid (PubChem CID 82926769) has the molecular formula C14H20O4S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-[4-(2-ethylbutylsulfonyl)phenyl]acetic acid.
| Compound Name | 2-[4-(2-ethylbutylsulfonyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 82926769 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-[4-(2-ethylbutylsulfonyl)phenyl]acetic acid |
| SMILES | CCC(CC)CS(=O)(=O)c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C14H20O4S/c1-3-11(4-2)10-19(17,18)13-7-5-12(6-8-13)9-14(15)16/h5-8,11H,3-4,9-10H2,1-2H3,(H,15,16) |
| InChIKey | NRILBCIACUQOMK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |