C14H20O5S — CID 115942726
2-[4-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]phenyl]acetic acid (PubChem CID 115942726) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[4-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]phenyl]acetic acid.
| Compound Name | 2-[4-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 115942726 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-[4-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]phenyl]acetic acid |
| SMILES | CC(C)(C)OCCS(=O)(=O)c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C14H20O5S/c1-14(2,3)19-8-9-20(17,18)12-6-4-11(5-7-12)10-13(15)16/h4-7H,8-10H2,1-3H3,(H,15,16) |
| InChIKey | FHJCTXBGGRPFMQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |