C8H16O5S — CID 112589540
2-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]acetic acid (PubChem CID 112589540) has the molecular formula C8H16O5S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]acetic acid.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]acetic acid |
|---|---|
| PubChem CID | 112589540 |
| Molecular Formula | C8H16O5S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxy]ethylsulfonyl]acetic acid |
| SMILES | CC(C)(C)OCCS(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C8H16O5S/c1-8(2,3)13-4-5-14(11,12)6-7(9)10/h4-6H2,1-3H3,(H,9,10) |
| InChIKey | DJOKECCWJBXLEQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |