C11H23NO3 — CID 112590569
2-[2-[(2-methylpropan-2-yl)oxy]ethyl-propan-2-ylamino]acetic acid (PubChem CID 112590569) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxy]ethyl-propan-2-ylamino]acetic acid.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxy]ethyl-propan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 112590569 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxy]ethyl-propan-2-ylamino]acetic acid |
| SMILES | CC(C)N(CCOC(C)(C)C)CC(=O)O |
| InChI | InChI=1S/C11H23NO3/c1-9(2)12(8-10(13)14)6-7-15-11(3,4)5/h9H,6-8H2,1-5H3,(H,13,14) |
| InChIKey | CUWJHOKZWVDNPN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |