C23H31NO3S — CID 11281066
2-[2-[2-(4-tert-butylphenyl)sulfanylphenoxy]ethyl-propan-2-ylamino]acetic acid (PubChem CID 11281066) has the molecular formula C23H31NO3S and a molecular weight of 401.57 g/mol. Its IUPAC name is 2-[2-[2-(4-tert-butylphenyl)sulfanylphenoxy]ethyl-propan-2-ylamino]acetic acid.
| Compound Name | 2-[2-[2-(4-tert-butylphenyl)sulfanylphenoxy]ethyl-propan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 11281066 |
| Molecular Formula | C23H31NO3S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[2-[2-(4-tert-butylphenyl)sulfanylphenoxy]ethyl-propan-2-ylamino]acetic acid |
| SMILES | CC(C)N(CCOc1ccccc1Sc1ccc(C(C)(C)C)cc1)CC(=O)O |
| InChI | InChI=1S/C23H31NO3S/c1-17(2)24(16-22(25)26)14-15-27-20-8-6-7-9-21(20)28-19-12-10-18(11-13-19)23(3,4)5/h6-13,17H,14-16H2,1-5H3,(H,25,26) |
| InChIKey | JOKIBAARUVNOTK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |