2-[2-formamidoethyl(propan-2-yl)amino]acetic acid

C8H16N2O3 — CID 118297525

IUPAC2-[2-formamidoethyl(propan-2-yl)amino]acetic acid
SMILESCC(C)N(CCNC=O)CC(=O)O
InChIInChI=1S/C8H16N2O3/c1-7(2)10(5-8(12)13)4-3-9-6-11/h6-7H,3-5H2,1-2H3,(H,9,11)(H,12,13)
InChIKeyXBHHACVCYHZUSS-UHFFFAOYSA-N
MW188.23 g/mol
LogP-0.47
Rot. Bonds7

About 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid

2-[2-formamidoethyl(propan-2-yl)amino]acetic acid (PubChem CID 118297525) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid.

Molecular Properties

Compound Name2-[2-formamidoethyl(propan-2-yl)amino]acetic acid
PubChem CID118297525
Molecular FormulaC8H16N2O3
Molecular Weight188.23 g/mol
Exact Mass188.12
IUPAC Name2-[2-formamidoethyl(propan-2-yl)amino]acetic acid
SMILESCC(C)N(CCNC=O)CC(=O)O
InChIInChI=1S/C8H16N2O3/c1-7(2)10(5-8(12)13)4-3-9-6-11/h6-7H,3-5H2,1-2H3,(H,9,11)(H,12,13)
InChIKeyXBHHACVCYHZUSS-UHFFFAOYSA-N
XLogP-0.47
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.23
LogP ≤ 5-0.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid?
The IUPAC name of 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid (CID 118297525) is 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid.
What is the SMILES notation for 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid?
The canonical SMILES for 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid is CC(C)N(CCNC=O)CC(=O)O.
What is the InChIKey of 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid?
The InChIKey is XBHHACVCYHZUSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O3/c1-7(2)10(5-8(12)13)4-3-9-6-11/h6-7H,3-5H2,1-2H3,(H,9,11)(H,12,13).
What are the key properties of 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid?
2-[2-formamidoethyl(propan-2-yl)amino]acetic acid has a molecular weight of 188.23 g/mol, XLogP of -0.47, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid is sourced from PubChem (CID 118297525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).