C8H16N2O3 — CID 118297525
2-[2-formamidoethyl(propan-2-yl)amino]acetic acid (PubChem CID 118297525) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid.
| Compound Name | 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid |
|---|---|
| PubChem CID | 118297525 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-[2-formamidoethyl(propan-2-yl)amino]acetic acid |
| SMILES | CC(C)N(CCNC=O)CC(=O)O |
| InChI | InChI=1S/C8H16N2O3/c1-7(2)10(5-8(12)13)4-3-9-6-11/h6-7H,3-5H2,1-2H3,(H,9,11)(H,12,13) |
| InChIKey | XBHHACVCYHZUSS-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|