C19H41N5O3 — CID 157189779
3-[methyl-[2-[2-[2-[2-[methyl(3-oxopropyl)amino]ethylamino]ethyl-propan-2-ylamino]ethylamino]ethyl]amino]propanoic acid (PubChem CID 157189779) has the molecular formula C19H41N5O3 and a molecular weight of 387.57 g/mol. Its IUPAC name is 3-[methyl-[2-[2-[2-[2-[methyl(3-oxopropyl)amino]ethylamino]ethyl-propan-2-ylamino]ethylamino]ethyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[2-[2-[2-[2-[methyl(3-oxopropyl)amino]ethylamino]ethyl-propan-2-ylamino]ethylamino]ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 157189779 |
| Molecular Formula | C19H41N5O3 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.32 |
| IUPAC Name | 3-[methyl-[2-[2-[2-[2-[methyl(3-oxopropyl)amino]ethylamino]ethyl-propan-2-ylamino]ethylamino]ethyl]amino]propanoic acid |
| SMILES | CC(C)N(CCNCCN(C)CCC=O)CCNCCN(C)CCC(=O)O |
| InChI | InChI=1S/C19H41N5O3/c1-18(2)24(15-9-20-7-13-22(3)11-5-17-25)16-10-21-8-14-23(4)12-6-19(26)27/h17-18,20-21H,5-16H2,1-4H3,(H,26,27) |
| InChIKey | HGAIOJRZNSCXSY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|