C8H15NO5S — CID 24709520
2-[2-(tert-butylamino)-2-oxoethyl]sulfonylacetic acid (PubChem CID 24709520) has the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-[2-(tert-butylamino)-2-oxoethyl]sulfonylacetic acid.
| Compound Name | 2-[2-(tert-butylamino)-2-oxoethyl]sulfonylacetic acid |
|---|---|
| PubChem CID | 24709520 |
| Molecular Formula | C8H15NO5S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-[2-(tert-butylamino)-2-oxoethyl]sulfonylacetic acid |
| SMILES | CC(C)(C)NC(=O)CS(=O)(=O)CC(=O)O |
| InChI | InChI=1S/C8H15NO5S/c1-8(2,3)9-6(10)4-15(13,14)5-7(11)12/h4-5H2,1-3H3,(H,9,10)(H,11,12) |
| InChIKey | DVEYTXZSVHHTKG-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |