C12H16N6O2 — CID 107043710
3-amino-4-[ethyl-[(2-methyltetrazol-5-yl)methyl]amino]benzoic acid (PubChem CID 107043710) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 3-amino-4-[ethyl-[(2-methyltetrazol-5-yl)methyl]amino]benzoic acid.
| Compound Name | 3-amino-4-[ethyl-[(2-methyltetrazol-5-yl)methyl]amino]benzoic acid |
|---|---|
| PubChem CID | 107043710 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 3-amino-4-[ethyl-[(2-methyltetrazol-5-yl)methyl]amino]benzoic acid |
| SMILES | CCN(Cc1nnn(C)n1)c1ccc(C(=O)O)cc1N |
| InChI | InChI=1S/C12H16N6O2/c1-3-18(7-11-14-16-17(2)15-11)10-5-4-8(12(19)20)6-9(10)13/h4-6H,3,7,13H2,1-2H3,(H,19,20) |
| InChIKey | FYFMROXVAFGWOA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|