C10H11N5O3 — CID 107044786
4-amino-3-[(2-methyltetrazol-5-yl)methoxy]benzoic acid (PubChem CID 107044786) has the molecular formula C10H11N5O3 and a molecular weight of 249.23 g/mol. Its IUPAC name is 4-amino-3-[(2-methyltetrazol-5-yl)methoxy]benzoic acid.
| Compound Name | 4-amino-3-[(2-methyltetrazol-5-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 107044786 |
| Molecular Formula | C10H11N5O3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-amino-3-[(2-methyltetrazol-5-yl)methoxy]benzoic acid |
| SMILES | Cn1nnc(COc2cc(C(=O)O)ccc2N)n1 |
| InChI | InChI=1S/C10H11N5O3/c1-15-13-9(12-14-15)5-18-8-4-6(10(16)17)2-3-7(8)11/h2-4H,5,11H2,1H3,(H,16,17) |
| InChIKey | SPJRTFJRHKRUPP-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|