C9H16N4O — CID 107044450
[3-[(1-methyltriazol-4-yl)methoxy]cyclobutyl]methanamine (PubChem CID 107044450) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is [3-[(1-methyltriazol-4-yl)methoxy]cyclobutyl]methanamine.
| Compound Name | [3-[(1-methyltriazol-4-yl)methoxy]cyclobutyl]methanamine |
|---|---|
| PubChem CID | 107044450 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | [3-[(1-methyltriazol-4-yl)methoxy]cyclobutyl]methanamine |
| SMILES | Cn1cc(COC2CC(CN)C2)nn1 |
| InChI | InChI=1S/C9H16N4O/c1-13-5-8(11-12-13)6-14-9-2-7(3-9)4-10/h5,7,9H,2-4,6,10H2,1H3 |
| InChIKey | NJDDVOWRSBIOEJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |