C8H14N4O — CID 107044452
3-[(1-methyltriazol-4-yl)methoxy]cyclobutan-1-amine (PubChem CID 107044452) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 3-[(1-methyltriazol-4-yl)methoxy]cyclobutan-1-amine.
| Compound Name | 3-[(1-methyltriazol-4-yl)methoxy]cyclobutan-1-amine |
|---|---|
| PubChem CID | 107044452 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 3-[(1-methyltriazol-4-yl)methoxy]cyclobutan-1-amine |
| SMILES | Cn1cc(COC2CC(N)C2)nn1 |
| InChI | InChI=1S/C8H14N4O/c1-12-4-7(10-11-12)5-13-8-2-6(9)3-8/h4,6,8H,2-3,5,9H2,1H3 |
| InChIKey | MFRWGJXNPKQLJG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |