C13H25N5 — CID 107045279
2-(aminomethyl)-N-ethyl-N-[(1-methyltriazol-4-yl)methyl]cyclohexan-1-amine (PubChem CID 107045279) has the molecular formula C13H25N5 and a molecular weight of 251.38 g/mol. Its IUPAC name is 2-(aminomethyl)-N-ethyl-N-[(1-methyltriazol-4-yl)methyl]cyclohexan-1-amine.
| Compound Name | 2-(aminomethyl)-N-ethyl-N-[(1-methyltriazol-4-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 107045279 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 2-(aminomethyl)-N-ethyl-N-[(1-methyltriazol-4-yl)methyl]cyclohexan-1-amine |
| SMILES | CCN(Cc1cn(C)nn1)C1CCCCC1CN |
| InChI | InChI=1S/C13H25N5/c1-3-18(10-12-9-17(2)16-15-12)13-7-5-4-6-11(13)8-14/h9,11,13H,3-8,10,14H2,1-2H3 |
| InChIKey | ARJYFUOXISZYJQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |