C10H17N5S — CID 107042943
3-[cyclopropyl-[(1-methyltriazol-4-yl)methyl]amino]propanethioamide (PubChem CID 107042943) has the molecular formula C10H17N5S and a molecular weight of 239.35 g/mol. Its IUPAC name is 3-[cyclopropyl-[(1-methyltriazol-4-yl)methyl]amino]propanethioamide.
| Compound Name | 3-[cyclopropyl-[(1-methyltriazol-4-yl)methyl]amino]propanethioamide |
|---|---|
| PubChem CID | 107042943 |
| Molecular Formula | C10H17N5S |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-[cyclopropyl-[(1-methyltriazol-4-yl)methyl]amino]propanethioamide |
| SMILES | Cn1cc(CN(CCC(N)=S)C2CC2)nn1 |
| InChI | InChI=1S/C10H17N5S/c1-14-6-8(12-13-14)7-15(9-2-3-9)5-4-10(11)16/h6,9H,2-5,7H2,1H3,(H2,11,16) |
| InChIKey | OFOUPHWKKAWXOG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|