C9H16N6S — CID 107042942
3-[cyclopropyl-[(2-methyltetrazol-5-yl)methyl]amino]propanethioamide (PubChem CID 107042942) has the molecular formula C9H16N6S and a molecular weight of 240.34 g/mol. Its IUPAC name is 3-[cyclopropyl-[(2-methyltetrazol-5-yl)methyl]amino]propanethioamide.
| Compound Name | 3-[cyclopropyl-[(2-methyltetrazol-5-yl)methyl]amino]propanethioamide |
|---|---|
| PubChem CID | 107042942 |
| Molecular Formula | C9H16N6S |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 3-[cyclopropyl-[(2-methyltetrazol-5-yl)methyl]amino]propanethioamide |
| SMILES | Cn1nnc(CN(CCC(N)=S)C2CC2)n1 |
| InChI | InChI=1S/C9H16N6S/c1-14-12-9(11-13-14)6-15(7-2-3-7)5-4-8(10)16/h7H,2-6H2,1H3,(H2,10,16) |
| InChIKey | HMRJMGGMHNMQQP-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|