C13H16Cl2N2S — CID 54997488
3-[cyclopropyl-[(2,6-dichlorophenyl)methyl]amino]propanethioamide (PubChem CID 54997488) has the molecular formula C13H16Cl2N2S and a molecular weight of 303.26 g/mol. Its IUPAC name is 3-[cyclopropyl-[(2,6-dichlorophenyl)methyl]amino]propanethioamide.
| Compound Name | 3-[cyclopropyl-[(2,6-dichlorophenyl)methyl]amino]propanethioamide |
|---|---|
| PubChem CID | 54997488 |
| Molecular Formula | C13H16Cl2N2S |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-[cyclopropyl-[(2,6-dichlorophenyl)methyl]amino]propanethioamide |
| SMILES | NC(=S)CCN(Cc1c(Cl)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C13H16Cl2N2S/c14-11-2-1-3-12(15)10(11)8-17(9-4-5-9)7-6-13(16)18/h1-3,9H,4-8H2,(H2,16,18) |
| InChIKey | CYJDLYOSZXJEDC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|