C12H14N6 — CID 107045487
[1-[(2-methyltetrazol-5-yl)methyl]indol-3-yl]methanamine (PubChem CID 107045487) has the molecular formula C12H14N6 and a molecular weight of 242.29 g/mol. Its IUPAC name is [1-[(2-methyltetrazol-5-yl)methyl]indol-3-yl]methanamine.
| Compound Name | [1-[(2-methyltetrazol-5-yl)methyl]indol-3-yl]methanamine |
|---|---|
| PubChem CID | 107045487 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [1-[(2-methyltetrazol-5-yl)methyl]indol-3-yl]methanamine |
| SMILES | Cn1nnc(Cn2cc(CN)c3ccccc32)n1 |
| InChI | InChI=1S/C12H14N6/c1-17-15-12(14-16-17)8-18-7-9(6-13)10-4-2-3-5-11(10)18/h2-5,7H,6,8,13H2,1H3 |
| InChIKey | ZCXSQWDQAPMGLQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |