C12H12F3N3OS — CID 107045943
2-(1-methyltriazol-4-yl)-1-[4-(trifluoromethylsulfanyl)phenyl]ethanol (PubChem CID 107045943) has the molecular formula C12H12F3N3OS and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-(1-methyltriazol-4-yl)-1-[4-(trifluoromethylsulfanyl)phenyl]ethanol.
| Compound Name | 2-(1-methyltriazol-4-yl)-1-[4-(trifluoromethylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 107045943 |
| Molecular Formula | C12H12F3N3OS |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-(1-methyltriazol-4-yl)-1-[4-(trifluoromethylsulfanyl)phenyl]ethanol |
| SMILES | Cn1cc(CC(O)c2ccc(SC(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C12H12F3N3OS/c1-18-7-9(16-17-18)6-11(19)8-2-4-10(5-3-8)20-12(13,14)15/h2-5,7,11,19H,6H2,1H3 |
| InChIKey | VRBWAKQKDVGXLD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |