C19H12F17N3O — CID 11387984
[1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)triazol-4-yl]-phenylmethanol (PubChem CID 11387984) has the molecular formula C19H12F17N3O and a molecular weight of 621.29 g/mol. Its IUPAC name is [1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)triazol-4-yl]-phenylmethanol.
| Compound Name | [1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)triazol-4-yl]-phenylmethanol |
|---|---|
| PubChem CID | 11387984 |
| Molecular Formula | C19H12F17N3O |
| Molecular Weight | 621.29 g/mol |
| Exact Mass | 621.07 |
| IUPAC Name | [1-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)triazol-4-yl]-phenylmethanol |
| SMILES | OC(c1ccccc1)c1cn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nn1 |
| InChI | InChI=1S/C19H12F17N3O/c20-12(21,6-7-39-8-10(37-38-39)11(40)9-4-2-1-3-5-9)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)36/h1-5,8,11,40H,6-7H2 |
| InChIKey | DKGXIHSARXSZEP-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.29 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|