C16H8F7N3O — CID 171351856
2,2,2-trifluoro-1-[2,3,5,6-tetrafluoro-4-(4-phenyltriazol-1-yl)phenyl]ethanol (PubChem CID 171351856) has the molecular formula C16H8F7N3O and a molecular weight of 391.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2,3,5,6-tetrafluoro-4-(4-phenyltriazol-1-yl)phenyl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[2,3,5,6-tetrafluoro-4-(4-phenyltriazol-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 171351856 |
| Molecular Formula | C16H8F7N3O |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2,2,2-trifluoro-1-[2,3,5,6-tetrafluoro-4-(4-phenyltriazol-1-yl)phenyl]ethanol |
| SMILES | OC(c1c(F)c(F)c(-n2cc(-c3ccccc3)nn2)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C16H8F7N3O/c17-10-9(15(27)16(21,22)23)11(18)13(20)14(12(10)19)26-6-8(24-25-26)7-4-2-1-3-5-7/h1-6,15,27H |
| InChIKey | CPEPASKRVSUALW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|