C20H18F6N4O — CID 164626005
2-[4-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylamino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 164626005) has the molecular formula C20H18F6N4O and a molecular weight of 444.38 g/mol. Its IUPAC name is 2-[4-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylamino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylamino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 164626005 |
| Molecular Formula | C20H18F6N4O |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 2-[4-[[1-(3,4-dimethylphenyl)triazol-4-yl]methylamino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1ccc(-n2cc(CNc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)nn2)cc1C |
| InChI | InChI=1S/C20H18F6N4O/c1-12-3-8-17(9-13(12)2)30-11-16(28-29-30)10-27-15-6-4-14(5-7-15)18(31,19(21,22)23)20(24,25)26/h3-9,11,27,31H,10H2,1-2H3 |
| InChIKey | ZWDFOMXGYCRQRZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |