C20H16F6N4O2 — CID 164628782
1-(3,4-dimethylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]triazole-4-carboxamide (PubChem CID 164628782) has the molecular formula C20H16F6N4O2 and a molecular weight of 458.36 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]triazole-4-carboxamide.
| Compound Name | 1-(3,4-dimethylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 164628782 |
| Molecular Formula | C20H16F6N4O2 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]triazole-4-carboxamide |
| SMILES | Cc1ccc(-n2cc(C(=O)Nc3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)nn2)cc1C |
| InChI | InChI=1S/C20H16F6N4O2/c1-11-3-8-15(9-12(11)2)30-10-16(28-29-30)17(31)27-14-6-4-13(5-7-14)18(32,19(21,22)23)20(24,25)26/h3-10,32H,1-2H3,(H,27,31) |
| InChIKey | RZCGAQJBVPAAHR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |