C17H15ClN4O2 — CID 155591167
N-(5-chloro-2-methylphenyl)-1-(3-hydroxy-4-methylphenyl)triazole-4-carboxamide (PubChem CID 155591167) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-1-(3-hydroxy-4-methylphenyl)triazole-4-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-1-(3-hydroxy-4-methylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 155591167 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-1-(3-hydroxy-4-methylphenyl)triazole-4-carboxamide |
| SMILES | Cc1ccc(-n2cc(C(=O)Nc3cc(Cl)ccc3C)nn2)cc1O |
| InChI | InChI=1S/C17H15ClN4O2/c1-10-3-5-12(18)7-14(10)19-17(24)15-9-22(21-20-15)13-6-4-11(2)16(23)8-13/h3-9,23H,1-2H3,(H,19,24) |
| InChIKey | ISWSGZAGZGGTKY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |