C16H19FN4O — CID 53332665
N-cyclohexyl-1-(4-fluoro-3-methylphenyl)triazole-4-carboxamide (PubChem CID 53332665) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is N-cyclohexyl-1-(4-fluoro-3-methylphenyl)triazole-4-carboxamide.
| Compound Name | N-cyclohexyl-1-(4-fluoro-3-methylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 53332665 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-cyclohexyl-1-(4-fluoro-3-methylphenyl)triazole-4-carboxamide |
| SMILES | Cc1cc(-n2cc(C(=O)NC3CCCCC3)nn2)ccc1F |
| InChI | InChI=1S/C16H19FN4O/c1-11-9-13(7-8-14(11)17)21-10-15(19-20-21)16(22)18-12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H,18,22) |
| InChIKey | OXNPKWQRVDHYPA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |