C15H18N4O2 — CID 104927751
N-[(1R,2R)-2-hydroxycyclohexyl]-1-phenyltriazole-4-carboxamide (PubChem CID 104927751) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-1-phenyltriazole-4-carboxamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-1-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 104927751 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-1-phenyltriazole-4-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C15H18N4O2/c20-14-9-5-4-8-12(14)16-15(21)13-10-19(18-17-13)11-6-2-1-3-7-11/h1-3,6-7,10,12,14,20H,4-5,8-9H2,(H,16,21)/t12-,14-/m1/s1 |
| InChIKey | RJTCZRANMPETEQ-TZMCWYRMSA-N |
| XLogP | 1.30 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |