C13H14N4O — CID 107046285
4-[2-hydroxy-1-(1-methyltriazol-4-yl)propan-2-yl]benzonitrile (PubChem CID 107046285) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-[2-hydroxy-1-(1-methyltriazol-4-yl)propan-2-yl]benzonitrile.
| Compound Name | 4-[2-hydroxy-1-(1-methyltriazol-4-yl)propan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 107046285 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-[2-hydroxy-1-(1-methyltriazol-4-yl)propan-2-yl]benzonitrile |
| SMILES | Cn1cc(CC(C)(O)c2ccc(C#N)cc2)nn1 |
| InChI | InChI=1S/C13H14N4O/c1-13(18,7-12-9-17(2)16-15-12)11-5-3-10(8-14)4-6-11/h3-6,9,18H,7H2,1-2H3 |
| InChIKey | SDHFZEMZDBIIJR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |