C13H12N2OS — CID 112642079
4-[2-hydroxy-1-(1,3-thiazol-5-yl)propan-2-yl]benzonitrile (PubChem CID 112642079) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is 4-[2-hydroxy-1-(1,3-thiazol-5-yl)propan-2-yl]benzonitrile.
| Compound Name | 4-[2-hydroxy-1-(1,3-thiazol-5-yl)propan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 112642079 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 4-[2-hydroxy-1-(1,3-thiazol-5-yl)propan-2-yl]benzonitrile |
| SMILES | CC(O)(Cc1cncs1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H12N2OS/c1-13(16,6-12-8-15-9-17-12)11-4-2-10(7-14)3-5-11/h2-5,8-9,16H,6H2,1H3 |
| InChIKey | PBDQEYFFKBEDMO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |