About 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone
1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone (PubChem CID 107047386) has the molecular formula C10H15N3OS2
and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone |
| PubChem CID | 107047386 |
| Molecular Formula | C10H15N3OS2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone |
| SMILES | CC1SCCSC1C(=O)Cc1cn(C)nn1 |
| InChI | InChI=1S/C10H15N3OS2/c1-7-10(16-4-3-15-7)9(14)5-8-6-13(2)12-11-8/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | SDIJBVYUUPIRFU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone?
The IUPAC name of 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone (CID 107047386) is 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone.
What is the SMILES notation for 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone?
The canonical SMILES for 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone is CC1SCCSC1C(=O)Cc1cn(C)nn1.
What is the InChIKey of 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone?
The InChIKey is SDIJBVYUUPIRFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3OS2/c1-7-10(16-4-3-15-7)9(14)5-8-6-13(2)12-11-8/h6-7,10H,3-5H2,1-2H3.
What are the key properties of 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone?
1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone has a molecular weight of 257.38 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanone is sourced from PubChem (CID 107047386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).