C9H15N3OS2 — CID 107047995
1-(1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanol (PubChem CID 107047995) has the molecular formula C9H15N3OS2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanol.
| Compound Name | 1-(1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanol |
|---|---|
| PubChem CID | 107047995 |
| Molecular Formula | C9H15N3OS2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-2-(1-methyltriazol-4-yl)ethanol |
| SMILES | Cn1cc(CC(O)C2CSCCS2)nn1 |
| InChI | InChI=1S/C9H15N3OS2/c1-12-5-7(10-11-12)4-8(13)9-6-14-2-3-15-9/h5,8-9,13H,2-4,6H2,1H3 |
| InChIKey | IIHIMXLLAGUAMZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |