C14H10Cl2N2O3 — CID 107048071
3,6-dichloro-2-[(5-methylpyridine-3-carbonyl)amino]benzoic acid (PubChem CID 107048071) has the molecular formula C14H10Cl2N2O3 and a molecular weight of 325.15 g/mol. Its IUPAC name is 3,6-dichloro-2-[(5-methylpyridine-3-carbonyl)amino]benzoic acid.
| Compound Name | 3,6-dichloro-2-[(5-methylpyridine-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107048071 |
| Molecular Formula | C14H10Cl2N2O3 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 3,6-dichloro-2-[(5-methylpyridine-3-carbonyl)amino]benzoic acid |
| SMILES | Cc1cncc(C(=O)Nc2c(Cl)ccc(Cl)c2C(=O)O)c1 |
| InChI | InChI=1S/C14H10Cl2N2O3/c1-7-4-8(6-17-5-7)13(19)18-12-10(16)3-2-9(15)11(12)14(20)21/h2-6H,1H3,(H,18,19)(H,20,21) |
| InChIKey | CZHGFWYDUDOGLX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |