C12H10O5 — CID 10704832
(3aR,5S,9bR)-5-methyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromene-2,6,9-trione (PubChem CID 10704832) has the molecular formula C12H10O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is (3aR,5S,9bR)-5-methyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromene-2,6,9-trione.
| Compound Name | (3aR,5S,9bR)-5-methyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromene-2,6,9-trione |
|---|---|
| PubChem CID | 10704832 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | (3aR,5S,9bR)-5-methyl-3,3a,5,9b-tetrahydrofuro[3,2-c]isochromene-2,6,9-trione |
| SMILES | C[C@@H]1O[C@@H]2CC(=O)O[C@@H]2C2=C1C(=O)C=CC2=O |
| InChI | InChI=1S/C12H10O5/c1-5-10-6(13)2-3-7(14)11(10)12-8(16-5)4-9(15)17-12/h2-3,5,8,12H,4H2,1H3/t5-,8+,12-/m0/s1 |
| InChIKey | NQSKKMLGZKIGHQ-MVISFBTESA-N |
| XLogP | 0.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|