C14H14ClN5 — CID 107049984
2-(2-amino-3-chlorophenyl)-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 107049984) has the molecular formula C14H14ClN5 and a molecular weight of 287.75 g/mol. Its IUPAC name is 2-(2-amino-3-chlorophenyl)-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-(2-amino-3-chlorophenyl)-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 107049984 |
| Molecular Formula | C14H14ClN5 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-(2-amino-3-chlorophenyl)-N,N-dimethyl-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CN(C)c1ccc2[nH]c(-c3cccc(Cl)c3N)nc2n1 |
| InChI | InChI=1S/C14H14ClN5/c1-20(2)11-7-6-10-14(18-11)19-13(17-10)8-4-3-5-9(15)12(8)16/h3-7H,16H2,1-2H3,(H,17,18,19) |
| InChIKey | SSFDAIOZPMFNOK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|