C11H8ClN5 — CID 107050425
2-chloro-6-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)aniline (PubChem CID 107050425) has the molecular formula C11H8ClN5 and a molecular weight of 245.67 g/mol. Its IUPAC name is 2-chloro-6-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)aniline.
| Compound Name | 2-chloro-6-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)aniline |
|---|---|
| PubChem CID | 107050425 |
| Molecular Formula | C11H8ClN5 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-chloro-6-([1,2,4]triazolo[4,3-b]pyridazin-3-yl)aniline |
| SMILES | Nc1c(Cl)cccc1-c1nnc2cccnn12 |
| InChI | InChI=1S/C11H8ClN5/c12-8-4-1-3-7(10(8)13)11-16-15-9-5-2-6-14-17(9)11/h1-6H,13H2 |
| InChIKey | KVXRDAYFGOIIBU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|