C13H12ClN5 — CID 107050381
2-chloro-6-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)aniline (PubChem CID 107050381) has the molecular formula C13H12ClN5 and a molecular weight of 273.73 g/mol. Its IUPAC name is 2-chloro-6-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)aniline.
| Compound Name | 2-chloro-6-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)aniline |
|---|---|
| PubChem CID | 107050381 |
| Molecular Formula | C13H12ClN5 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-chloro-6-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)aniline |
| SMILES | Cc1cc(C)n2c(-c3cccc(Cl)c3N)nnc2n1 |
| InChI | InChI=1S/C13H12ClN5/c1-7-6-8(2)19-12(17-18-13(19)16-7)9-4-3-5-10(14)11(9)15/h3-6H,15H2,1-2H3 |
| InChIKey | GNNFCCKLKKASIG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|