C10H18F2N4O — CID 107051436
4-(2,2-difluoroethoxy)-N-methyl-1-(1-methyltriazol-4-yl)butan-2-amine (PubChem CID 107051436) has the molecular formula C10H18F2N4O and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-N-methyl-1-(1-methyltriazol-4-yl)butan-2-amine.
| Compound Name | 4-(2,2-difluoroethoxy)-N-methyl-1-(1-methyltriazol-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 107051436 |
| Molecular Formula | C10H18F2N4O |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-N-methyl-1-(1-methyltriazol-4-yl)butan-2-amine |
| SMILES | CNC(CCOCC(F)F)Cc1cn(C)nn1 |
| InChI | InChI=1S/C10H18F2N4O/c1-13-8(3-4-17-7-10(11)12)5-9-6-16(2)15-14-9/h6,8,10,13H,3-5,7H2,1-2H3 |
| InChIKey | DMLHPHJPWWUEDT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|