C10H20N4O — CID 107064582
N-methyl-1-(1-methyltriazol-4-yl)-3-propan-2-yloxypropan-2-amine (PubChem CID 107064582) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is N-methyl-1-(1-methyltriazol-4-yl)-3-propan-2-yloxypropan-2-amine.
| Compound Name | N-methyl-1-(1-methyltriazol-4-yl)-3-propan-2-yloxypropan-2-amine |
|---|---|
| PubChem CID | 107064582 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | N-methyl-1-(1-methyltriazol-4-yl)-3-propan-2-yloxypropan-2-amine |
| SMILES | CNC(COC(C)C)Cc1cn(C)nn1 |
| InChI | InChI=1S/C10H20N4O/c1-8(2)15-7-10(11-3)5-9-6-14(4)13-12-9/h6,8,10-11H,5,7H2,1-4H3 |
| InChIKey | RLEOIGZSOWQMCD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |