C9H19N5O — CID 107066743
[1-(1-methyltriazol-4-yl)-3-propan-2-yloxypropan-2-yl]hydrazine (PubChem CID 107066743) has the molecular formula C9H19N5O and a molecular weight of 213.28 g/mol. Its IUPAC name is [1-(1-methyltriazol-4-yl)-3-propan-2-yloxypropan-2-yl]hydrazine.
| Compound Name | [1-(1-methyltriazol-4-yl)-3-propan-2-yloxypropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 107066743 |
| Molecular Formula | C9H19N5O |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | [1-(1-methyltriazol-4-yl)-3-propan-2-yloxypropan-2-yl]hydrazine |
| SMILES | CC(C)OCC(Cc1cn(C)nn1)NN |
| InChI | InChI=1S/C9H19N5O/c1-7(2)15-6-9(11-10)4-8-5-14(3)13-12-8/h5,7,9,11H,4,6,10H2,1-3H3 |
| InChIKey | PDRYPPZHBQWMPI-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|