C8H10ClN5O2S — CID 107051968
2-methyl-1-[(1-methyltriazol-4-yl)methyl]imidazole-4-sulfonyl chloride (PubChem CID 107051968) has the molecular formula C8H10ClN5O2S and a molecular weight of 275.72 g/mol. Its IUPAC name is 2-methyl-1-[(1-methyltriazol-4-yl)methyl]imidazole-4-sulfonyl chloride.
| Compound Name | 2-methyl-1-[(1-methyltriazol-4-yl)methyl]imidazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 107051968 |
| Molecular Formula | C8H10ClN5O2S |
| Molecular Weight | 275.72 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 2-methyl-1-[(1-methyltriazol-4-yl)methyl]imidazole-4-sulfonyl chloride |
| SMILES | Cc1nc(S(=O)(=O)Cl)cn1Cc1cn(C)nn1 |
| InChI | InChI=1S/C8H10ClN5O2S/c1-6-10-8(17(9,15)16)5-14(6)4-7-3-13(2)12-11-7/h3,5H,4H2,1-2H3 |
| InChIKey | SEEVAQAAOUUAJW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.72 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |